C26H33N3 — CID 134484536
(3Z,5Z)-3-[(1Z)-buta-1,3-dienyl]-N-[5-(6,7-dihydro-1,8-naphthyridin-2-yl)-2-methylpent-2-en-3-yl]-4-methylhepta-3,5-dien-2-imine (PubChem CID 134484536) has the molecular formula C26H33N3 and a molecular weight of 387.57 g/mol. Its IUPAC name is (3Z,5Z)-3-[(1Z)-buta-1,3-dienyl]-N-[5-(6,7-dihydro-1,8-naphthyridin-2-yl)-2-methylpent-2-en-3-yl]-4-methylhepta-3,5-dien-2-imine.
| Compound Name | (3Z,5Z)-3-[(1Z)-buta-1,3-dienyl]-N-[5-(6,7-dihydro-1,8-naphthyridin-2-yl)-2-methylpent-2-en-3-yl]-4-methylhepta-3,5-dien-2-imine |
|---|---|
| PubChem CID | 134484536 |
| Molecular Formula | C26H33N3 |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.27 |
| IUPAC Name | (3Z,5Z)-3-[(1Z)-buta-1,3-dienyl]-N-[5-(6,7-dihydro-1,8-naphthyridin-2-yl)-2-methylpent-2-en-3-yl]-4-methylhepta-3,5-dien-2-imine |
| SMILES | C=C/C=C\C(=C(C)\C=C/C)\C(C)=N\C(CCc1ccc2c(n1)=NCCC=2)=C(C)C |
| InChI | InChI=1S/C26H33N3/c1-7-9-13-24(20(5)11-8-2)21(6)28-25(19(3)4)17-16-23-15-14-22-12-10-18-27-26(22)29-23/h7-9,11-15H,1,10,16-18H2,2-6H3/b11-8-,13-9-,24-20-,28-21+ |
| InChIKey | IARGFTSTRHQYSF-GCIOZVCDSA-N |
| XLogP | 5.21 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|