C15H24S — CID 134484567
(1S,2S,4R,9aS,9bR)-1,2,4-trimethyl-1,2,3,4,4a,5a,6,7,9a,9b-decahydrodibenzothiophene (PubChem CID 134484567) has the molecular formula C15H24S and a molecular weight of 236.42 g/mol. Its IUPAC name is (1S,2S,4R,9aS,9bR)-1,2,4-trimethyl-1,2,3,4,4a,5a,6,7,9a,9b-decahydrodibenzothiophene.
| Compound Name | (1S,2S,4R,9aS,9bR)-1,2,4-trimethyl-1,2,3,4,4a,5a,6,7,9a,9b-decahydrodibenzothiophene |
|---|---|
| PubChem CID | 134484567 |
| Molecular Formula | C15H24S |
| Molecular Weight | 236.42 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | (1S,2S,4R,9aS,9bR)-1,2,4-trimethyl-1,2,3,4,4a,5a,6,7,9a,9b-decahydrodibenzothiophene |
| SMILES | C[C@@H]1[C@H]2C(SC3CCC=C[C@H]32)[C@H](C)C[C@@H]1C |
| InChI | InChI=1S/C15H24S/c1-9-8-10(2)15-14(11(9)3)12-6-4-5-7-13(12)16-15/h4,6,9-15H,5,7-8H2,1-3H3/t9-,10+,11-,12+,13?,14+,15?/m0/s1 |
| InChIKey | VTFZFCDHNDCCSL-GJENTYHWSA-N |
| XLogP | 4.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.42 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|