C8H11NO2 — CID 134485037
5-(aminomethyl)cyclohepta-1,3,6-triene-1,3-diol (PubChem CID 134485037) has the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. Its IUPAC name is 5-(aminomethyl)cyclohepta-1,3,6-triene-1,3-diol.
| Compound Name | 5-(aminomethyl)cyclohepta-1,3,6-triene-1,3-diol |
|---|---|
| PubChem CID | 134485037 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | 5-(aminomethyl)cyclohepta-1,3,6-triene-1,3-diol |
| SMILES | NCC1C=CC(O)=CC(O)=C1 |
| InChI | InChI=1S/C8H11NO2/c9-5-6-1-2-7(10)4-8(11)3-6/h1-4,6,10-11H,5,9H2 |
| InChIKey | VNSZUSOLJAORJR-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |