C12H18O3 — CID 134485240
(2R,3R,4R)-2-[(2R)-butan-2-yl]-2-ethenyl-3-ethynyloxolane-3,4-diol (PubChem CID 134485240) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is (2R,3R,4R)-2-[(2R)-butan-2-yl]-2-ethenyl-3-ethynyloxolane-3,4-diol.
| Compound Name | (2R,3R,4R)-2-[(2R)-butan-2-yl]-2-ethenyl-3-ethynyloxolane-3,4-diol |
|---|---|
| PubChem CID | 134485240 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (2R,3R,4R)-2-[(2R)-butan-2-yl]-2-ethenyl-3-ethynyloxolane-3,4-diol |
| SMILES | C#C[C@@]1(O)[C@H](O)CO[C@]1(C=C)[C@H](C)CC |
| InChI | InChI=1S/C12H18O3/c1-5-9(4)12(7-3)11(14,6-2)10(13)8-15-12/h2,7,9-10,13-14H,3,5,8H2,1,4H3/t9-,10-,11-,12-/m1/s1 |
| InChIKey | NSYAKGJGAUTUSE-DDHJBXDOSA-N |
| XLogP | 0.71 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|