C12H18BrNOS — CID 134485258
N-[4-bromo-3-(2,2-dimethylpropyl)phenyl]methanesulfinamide (PubChem CID 134485258) has the molecular formula C12H18BrNOS and a molecular weight of 304.25 g/mol. Its IUPAC name is N-[4-bromo-3-(2,2-dimethylpropyl)phenyl]methanesulfinamide.
| Compound Name | N-[4-bromo-3-(2,2-dimethylpropyl)phenyl]methanesulfinamide |
|---|---|
| PubChem CID | 134485258 |
| Molecular Formula | C12H18BrNOS |
| Molecular Weight | 304.25 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | N-[4-bromo-3-(2,2-dimethylpropyl)phenyl]methanesulfinamide |
| SMILES | CS(=O)Nc1ccc(Br)c(CC(C)(C)C)c1 |
| InChI | InChI=1S/C12H18BrNOS/c1-12(2,3)8-9-7-10(14-16(4)15)5-6-11(9)13/h5-7,14H,8H2,1-4H3 |
| InChIKey | VGKSJLYZMUNATK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.25 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |