About (Z)-3-methoxy-N,N-dimethylprop-1-en-1-amine
(Z)-3-methoxy-N,N-dimethylprop-1-en-1-amine (PubChem CID 134485327) has the molecular formula C6H13NO
and a molecular weight of 115.18 g/mol. Its IUPAC name is (Z)-3-methoxy-N,N-dimethylprop-1-en-1-amine.
Molecular Properties
| Compound Name | (Z)-3-methoxy-N,N-dimethylprop-1-en-1-amine |
| PubChem CID | 134485327 |
| Molecular Formula | C6H13NO |
| Molecular Weight | 115.18 g/mol |
| Exact Mass | 115.10 |
| IUPAC Name | (Z)-3-methoxy-N,N-dimethylprop-1-en-1-amine |
| SMILES | COC/C=C\N(C)C |
| InChI | InChI=1S/C6H13NO/c1-7(2)5-4-6-8-3/h4-5H,6H2,1-3H3/b5-4- |
| InChIKey | RSMZLBXTBVFUEJ-PLNGDYQASA-N |
| XLogP | 0.71 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.18 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (Z)-3-methoxy-N,N-dimethylprop-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-methoxy-N,N-dimethylprop-1-en-1-amine?
The IUPAC name of (Z)-3-methoxy-N,N-dimethylprop-1-en-1-amine (CID 134485327) is (Z)-3-methoxy-N,N-dimethylprop-1-en-1-amine.
What is the SMILES notation for (Z)-3-methoxy-N,N-dimethylprop-1-en-1-amine?
The canonical SMILES for (Z)-3-methoxy-N,N-dimethylprop-1-en-1-amine is COC/C=C\N(C)C.
What is the InChIKey of (Z)-3-methoxy-N,N-dimethylprop-1-en-1-amine?
The InChIKey is RSMZLBXTBVFUEJ-PLNGDYQASA-N. The full InChI is InChI=1S/C6H13NO/c1-7(2)5-4-6-8-3/h4-5H,6H2,1-3H3/b5-4-.
What are the key properties of (Z)-3-methoxy-N,N-dimethylprop-1-en-1-amine?
(Z)-3-methoxy-N,N-dimethylprop-1-en-1-amine has a molecular weight of 115.18 g/mol, XLogP of 0.71, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-methoxy-N,N-dimethylprop-1-en-1-amine is sourced from PubChem (CID 134485327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).