About 6-methyl-2,3-dihydropyridin-2-amine
6-methyl-2,3-dihydropyridin-2-amine (PubChem CID 134485520) has the molecular formula C6H10N2
and a molecular weight of 110.16 g/mol. Its IUPAC name is 6-methyl-2,3-dihydropyridin-2-amine.
Molecular Properties
| Compound Name | 6-methyl-2,3-dihydropyridin-2-amine |
| PubChem CID | 134485520 |
| Molecular Formula | C6H10N2 |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.08 |
| IUPAC Name | 6-methyl-2,3-dihydropyridin-2-amine |
| SMILES | CC1=NC(N)CC=C1 |
| InChI | InChI=1S/C6H10N2/c1-5-3-2-4-6(7)8-5/h2-3,6H,4,7H2,1H3 |
| InChIKey | VFJGKGPILHUEIQ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methyl-2,3-dihydropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2,3-dihydropyridin-2-amine?
The IUPAC name of 6-methyl-2,3-dihydropyridin-2-amine (CID 134485520) is 6-methyl-2,3-dihydropyridin-2-amine.
What is the SMILES notation for 6-methyl-2,3-dihydropyridin-2-amine?
The canonical SMILES for 6-methyl-2,3-dihydropyridin-2-amine is CC1=NC(N)CC=C1.
What is the InChIKey of 6-methyl-2,3-dihydropyridin-2-amine?
The InChIKey is VFJGKGPILHUEIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2/c1-5-3-2-4-6(7)8-5/h2-3,6H,4,7H2,1H3.
What are the key properties of 6-methyl-2,3-dihydropyridin-2-amine?
6-methyl-2,3-dihydropyridin-2-amine has a molecular weight of 110.16 g/mol, XLogP of 0.69, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2,3-dihydropyridin-2-amine is sourced from PubChem (CID 134485520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).