About N'-[2-(but-3-en-2-ylideneamino)ethyl]-N-methylethane-1,2-diamine
N'-[2-(but-3-en-2-ylideneamino)ethyl]-N-methylethane-1,2-diamine (PubChem CID 134485867) has the molecular formula C9H19N3
and a molecular weight of 169.27 g/mol. Its IUPAC name is N'-[2-(but-3-en-2-ylideneamino)ethyl]-N-methylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-[2-(but-3-en-2-ylideneamino)ethyl]-N-methylethane-1,2-diamine |
| PubChem CID | 134485867 |
| Molecular Formula | C9H19N3 |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.16 |
| IUPAC Name | N'-[2-(but-3-en-2-ylideneamino)ethyl]-N-methylethane-1,2-diamine |
| SMILES | C=C/C(C)=N/CCNCCNC |
| InChI | InChI=1S/C9H19N3/c1-4-9(2)12-8-7-11-6-5-10-3/h4,10-11H,1,5-8H2,2-3H3/b12-9+ |
| InChIKey | GIELSMYRAVDYDI-FMIVXFBMSA-N |
| XLogP | 0.44 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N'-[2-(but-3-en-2-ylideneamino)ethyl]-N-methylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-(but-3-en-2-ylideneamino)ethyl]-N-methylethane-1,2-diamine?
The IUPAC name of N'-[2-(but-3-en-2-ylideneamino)ethyl]-N-methylethane-1,2-diamine (CID 134485867) is N'-[2-(but-3-en-2-ylideneamino)ethyl]-N-methylethane-1,2-diamine.
What is the SMILES notation for N'-[2-(but-3-en-2-ylideneamino)ethyl]-N-methylethane-1,2-diamine?
The canonical SMILES for N'-[2-(but-3-en-2-ylideneamino)ethyl]-N-methylethane-1,2-diamine is C=C/C(C)=N/CCNCCNC.
What is the InChIKey of N'-[2-(but-3-en-2-ylideneamino)ethyl]-N-methylethane-1,2-diamine?
The InChIKey is GIELSMYRAVDYDI-FMIVXFBMSA-N. The full InChI is InChI=1S/C9H19N3/c1-4-9(2)12-8-7-11-6-5-10-3/h4,10-11H,1,5-8H2,2-3H3/b12-9+.
What are the key properties of N'-[2-(but-3-en-2-ylideneamino)ethyl]-N-methylethane-1,2-diamine?
N'-[2-(but-3-en-2-ylideneamino)ethyl]-N-methylethane-1,2-diamine has a molecular weight of 169.27 g/mol, XLogP of 0.44, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-(but-3-en-2-ylideneamino)ethyl]-N-methylethane-1,2-diamine is sourced from PubChem (CID 134485867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).