C24H25ClN4O — CID 134485869
N-(4-chloro-3,5-dimethylphenyl)-5-[4-[(3E,5Z)-2-methylhepta-1,3,5-trien-4-yl]oxyphenyl]-1H-1,2,4-triazol-3-amine (PubChem CID 134485869) has the molecular formula C24H25ClN4O and a molecular weight of 420.94 g/mol. Its IUPAC name is N-(4-chloro-3,5-dimethylphenyl)-5-[4-[(3E,5Z)-2-methylhepta-1,3,5-trien-4-yl]oxyphenyl]-1H-1,2,4-triazol-3-amine.
| Compound Name | N-(4-chloro-3,5-dimethylphenyl)-5-[4-[(3E,5Z)-2-methylhepta-1,3,5-trien-4-yl]oxyphenyl]-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 134485869 |
| Molecular Formula | C24H25ClN4O |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | N-(4-chloro-3,5-dimethylphenyl)-5-[4-[(3E,5Z)-2-methylhepta-1,3,5-trien-4-yl]oxyphenyl]-1H-1,2,4-triazol-3-amine |
| SMILES | C=C(C)/C=C(\C=C/C)Oc1ccc(-c2nc(Nc3cc(C)c(Cl)c(C)c3)n[nH]2)cc1 |
| InChI | InChI=1S/C24H25ClN4O/c1-6-7-21(12-15(2)3)30-20-10-8-18(9-11-20)23-27-24(29-28-23)26-19-13-16(4)22(25)17(5)14-19/h6-14H,2H2,1,3-5H3,(H2,26,27,28,29)/b7-6-,21-12+ |
| InChIKey | XNLHDZLLLRCTMO-APGSTLKMSA-N |
| XLogP | 6.90 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|