C23H23ClN4O — CID 134485898
N-(4-chloro-3,5-dimethylphenyl)-5-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxyphenyl]-1H-1,2,4-triazol-3-amine (PubChem CID 134485898) has the molecular formula C23H23ClN4O and a molecular weight of 406.92 g/mol. Its IUPAC name is N-(4-chloro-3,5-dimethylphenyl)-5-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxyphenyl]-1H-1,2,4-triazol-3-amine.
| Compound Name | N-(4-chloro-3,5-dimethylphenyl)-5-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxyphenyl]-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 134485898 |
| Molecular Formula | C23H23ClN4O |
| Molecular Weight | 406.92 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | N-(4-chloro-3,5-dimethylphenyl)-5-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxyphenyl]-1H-1,2,4-triazol-3-amine |
| SMILES | C=C/C=C(\C=C/C)Oc1ccc(-c2nc(Nc3cc(C)c(Cl)c(C)c3)n[nH]2)cc1 |
| InChI | InChI=1S/C23H23ClN4O/c1-5-7-19(8-6-2)29-20-11-9-17(10-12-20)22-26-23(28-27-22)25-18-13-15(3)21(24)16(4)14-18/h5-14H,1H2,2-4H3,(H2,25,26,27,28)/b8-6-,19-7+ |
| InChIKey | YKCSFSKHPUWAKL-VGIFIUIKSA-N |
| XLogP | 6.51 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.92 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|