About 6-tert-butyl-2,5-bis(trifluoromethyl)cyclohexa-1,3-diene
6-tert-butyl-2,5-bis(trifluoromethyl)cyclohexa-1,3-diene (PubChem CID 134486006) has the molecular formula C12H14F6
and a molecular weight of 272.23 g/mol. Its IUPAC name is 6-tert-butyl-2,5-bis(trifluoromethyl)cyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 6-tert-butyl-2,5-bis(trifluoromethyl)cyclohexa-1,3-diene |
| PubChem CID | 134486006 |
| Molecular Formula | C12H14F6 |
| Molecular Weight | 272.23 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 6-tert-butyl-2,5-bis(trifluoromethyl)cyclohexa-1,3-diene |
| SMILES | CC(C)(C)C1C=C(C(F)(F)F)C=CC1C(F)(F)F |
| InChI | InChI=1S/C12H14F6/c1-10(2,3)9-6-7(11(13,14)15)4-5-8(9)12(16,17)18/h4-6,8-9H,1-3H3 |
| InChIKey | PLSLGCSUGDRDOG-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.23 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 6-tert-butyl-2,5-bis(trifluoromethyl)cyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-2,5-bis(trifluoromethyl)cyclohexa-1,3-diene?
The IUPAC name of 6-tert-butyl-2,5-bis(trifluoromethyl)cyclohexa-1,3-diene (CID 134486006) is 6-tert-butyl-2,5-bis(trifluoromethyl)cyclohexa-1,3-diene.
What is the SMILES notation for 6-tert-butyl-2,5-bis(trifluoromethyl)cyclohexa-1,3-diene?
The canonical SMILES for 6-tert-butyl-2,5-bis(trifluoromethyl)cyclohexa-1,3-diene is CC(C)(C)C1C=C(C(F)(F)F)C=CC1C(F)(F)F.
What is the InChIKey of 6-tert-butyl-2,5-bis(trifluoromethyl)cyclohexa-1,3-diene?
The InChIKey is PLSLGCSUGDRDOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F6/c1-10(2,3)9-6-7(11(13,14)15)4-5-8(9)12(16,17)18/h4-6,8-9H,1-3H3.
What are the key properties of 6-tert-butyl-2,5-bis(trifluoromethyl)cyclohexa-1,3-diene?
6-tert-butyl-2,5-bis(trifluoromethyl)cyclohexa-1,3-diene has a molecular weight of 272.23 g/mol, XLogP of 4.89, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-2,5-bis(trifluoromethyl)cyclohexa-1,3-diene is sourced from PubChem (CID 134486006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).