C19H22O4 — CID 134486102
(4'aS,5'S,8'aS)-5'-methyl-8'a-phenylspiro[1,3-dioxolane-2,6'-3,4,4a,5,7,8-hexahydronaphthalene]-1',2'-dione (PubChem CID 134486102) has the molecular formula C19H22O4 and a molecular weight of 314.38 g/mol. Its IUPAC name is (4'aS,5'S,8'aS)-5'-methyl-8'a-phenylspiro[1,3-dioxolane-2,6'-3,4,4a,5,7,8-hexahydronaphthalene]-1',2'-dione.
| Compound Name | (4'aS,5'S,8'aS)-5'-methyl-8'a-phenylspiro[1,3-dioxolane-2,6'-3,4,4a,5,7,8-hexahydronaphthalene]-1',2'-dione |
|---|---|
| PubChem CID | 134486102 |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | (4'aS,5'S,8'aS)-5'-methyl-8'a-phenylspiro[1,3-dioxolane-2,6'-3,4,4a,5,7,8-hexahydronaphthalene]-1',2'-dione |
| SMILES | C[C@H]1[C@@H]2CCC(=O)C(=O)[C@@]2(c2ccccc2)CCC12OCCO2 |
| InChI | InChI=1S/C19H22O4/c1-13-15-7-8-16(20)17(21)18(15,14-5-3-2-4-6-14)9-10-19(13)22-11-12-23-19/h2-6,13,15H,7-12H2,1H3/t13-,15-,18+/m0/s1 |
| InChIKey | IJLYKLLQRBSCSP-DHSIGJKJSA-N |
| XLogP | 2.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|