C35H49NO — CID 134486412
2,2,6,6-tetramethyl-1-[(E)-pent-3-enyl]-4-[4-[4-(4-propoxycyclohexen-1-yl)phenyl]phenyl]piperidine (PubChem CID 134486412) has the molecular formula C35H49NO and a molecular weight of 499.78 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1-[(E)-pent-3-enyl]-4-[4-[4-(4-propoxycyclohexen-1-yl)phenyl]phenyl]piperidine.
| Compound Name | 2,2,6,6-tetramethyl-1-[(E)-pent-3-enyl]-4-[4-[4-(4-propoxycyclohexen-1-yl)phenyl]phenyl]piperidine |
|---|---|
| PubChem CID | 134486412 |
| Molecular Formula | C35H49NO |
| Molecular Weight | 499.78 g/mol |
| Exact Mass | 499.38 |
| IUPAC Name | 2,2,6,6-tetramethyl-1-[(E)-pent-3-enyl]-4-[4-[4-(4-propoxycyclohexen-1-yl)phenyl]phenyl]piperidine |
| SMILES | C/C=C/CCN1C(C)(C)CC(c2ccc(-c3ccc(C4=CCC(OCCC)CC4)cc3)cc2)CC1(C)C |
| InChI | InChI=1S/C35H49NO/c1-7-9-10-23-36-34(3,4)25-32(26-35(36,5)6)31-17-15-28(16-18-31)27-11-13-29(14-12-27)30-19-21-33(22-20-30)37-24-8-2/h7,9,11-19,32-33H,8,10,20-26H2,1-6H3/b9-7+ |
| InChIKey | KPRGBLVUZXXYNN-VQHVLOKHSA-N |
| XLogP | 9.42 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.78 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|