C34H48FNO — CID 134486531
1-but-3-enyl-4-[2-fluoro-4-[4-(4-propoxycyclohexyl)phenyl]phenyl]-2,2,6,6-tetramethylpiperidine (PubChem CID 134486531) has the molecular formula C34H48FNO and a molecular weight of 505.76 g/mol. Its IUPAC name is 1-but-3-enyl-4-[2-fluoro-4-[4-(4-propoxycyclohexyl)phenyl]phenyl]-2,2,6,6-tetramethylpiperidine.
| Compound Name | 1-but-3-enyl-4-[2-fluoro-4-[4-(4-propoxycyclohexyl)phenyl]phenyl]-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 134486531 |
| Molecular Formula | C34H48FNO |
| Molecular Weight | 505.76 g/mol |
| Exact Mass | 505.37 |
| IUPAC Name | 1-but-3-enyl-4-[2-fluoro-4-[4-(4-propoxycyclohexyl)phenyl]phenyl]-2,2,6,6-tetramethylpiperidine |
| SMILES | C=CCCN1C(C)(C)CC(c2ccc(-c3ccc(C4CCC(OCCC)CC4)cc3)cc2F)CC1(C)C |
| InChI | InChI=1S/C34H48FNO/c1-7-9-20-36-33(3,4)23-29(24-34(36,5)6)31-19-16-28(22-32(31)35)27-12-10-25(11-13-27)26-14-17-30(18-15-26)37-21-8-2/h7,10-13,16,19,22,26,29-30H,1,8-9,14-15,17-18,20-21,23-24H2,2-6H3 |
| InChIKey | OVMKTSPOAHRURS-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.76 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|