C25H41NO — CID 134486625
1,2,2,6,6-pentamethyl-4-[4-(4-propoxycyclohexyl)phenyl]piperidine (PubChem CID 134486625) has the molecular formula C25H41NO and a molecular weight of 371.61 g/mol. Its IUPAC name is 1,2,2,6,6-pentamethyl-4-[4-(4-propoxycyclohexyl)phenyl]piperidine.
| Compound Name | 1,2,2,6,6-pentamethyl-4-[4-(4-propoxycyclohexyl)phenyl]piperidine |
|---|---|
| PubChem CID | 134486625 |
| Molecular Formula | C25H41NO |
| Molecular Weight | 371.61 g/mol |
| Exact Mass | 371.32 |
| IUPAC Name | 1,2,2,6,6-pentamethyl-4-[4-(4-propoxycyclohexyl)phenyl]piperidine |
| SMILES | CCCOC1CCC(c2ccc(C3CC(C)(C)N(C)C(C)(C)C3)cc2)CC1 |
| InChI | InChI=1S/C25H41NO/c1-7-16-27-23-14-12-20(13-15-23)19-8-10-21(11-9-19)22-17-24(2,3)26(6)25(4,5)18-22/h8-11,20,22-23H,7,12-18H2,1-6H3 |
| InChIKey | GKLROTWSCZKBRO-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.61 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |