C23H34FNO — CID 134486670
4-[2-fluoro-4-[(3E)-hepta-3,6-dienyl]phenyl]-1-methoxy-2,2,6,6-tetramethylpiperidine (PubChem CID 134486670) has the molecular formula C23H34FNO and a molecular weight of 359.53 g/mol. Its IUPAC name is 4-[2-fluoro-4-[(3E)-hepta-3,6-dienyl]phenyl]-1-methoxy-2,2,6,6-tetramethylpiperidine.
| Compound Name | 4-[2-fluoro-4-[(3E)-hepta-3,6-dienyl]phenyl]-1-methoxy-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 134486670 |
| Molecular Formula | C23H34FNO |
| Molecular Weight | 359.53 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | 4-[2-fluoro-4-[(3E)-hepta-3,6-dienyl]phenyl]-1-methoxy-2,2,6,6-tetramethylpiperidine |
| SMILES | C=CC/C=C/CCc1ccc(C2CC(C)(C)N(OC)C(C)(C)C2)c(F)c1 |
| InChI | InChI=1S/C23H34FNO/c1-7-8-9-10-11-12-18-13-14-20(21(24)15-18)19-16-22(2,3)25(26-6)23(4,5)17-19/h7,9-10,13-15,19H,1,8,11-12,16-17H2,2-6H3/b10-9+ |
| InChIKey | SXZPBWXVNFYIIX-MDZDMXLPSA-N |
| XLogP | 6.19 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.53 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|