About 2-[[2-(5-acetyl-3-oxo-2,5-diazaspiro[3.4]octan-2-yl)acetyl]amino]-3-methylbutanamide
2-[[2-(5-acetyl-3-oxo-2,5-diazaspiro[3.4]octan-2-yl)acetyl]amino]-3-methylbutanamide (PubChem CID 134486903) has the molecular formula C15H24N4O4
and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-[[2-(5-acetyl-3-oxo-2,5-diazaspiro[3.4]octan-2-yl)acetyl]amino]-3-methylbutanamide.
Molecular Properties
| Compound Name | 2-[[2-(5-acetyl-3-oxo-2,5-diazaspiro[3.4]octan-2-yl)acetyl]amino]-3-methylbutanamide |
| PubChem CID | 134486903 |
| Molecular Formula | C15H24N4O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 2-[[2-(5-acetyl-3-oxo-2,5-diazaspiro[3.4]octan-2-yl)acetyl]amino]-3-methylbutanamide |
| SMILES | CC(=O)N1CCCC12CN(CC(=O)NC(C(N)=O)C(C)C)C2=O |
| InChI | InChI=1S/C15H24N4O4/c1-9(2)12(13(16)22)17-11(21)7-18-8-15(14(18)23)5-4-6-19(15)10(3)20/h9,12H,4-8H2,1-3H3,(H2,16,22)(H,17,21) |
| InChIKey | WKAJVTJJOUZJSO-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[2-(5-acetyl-3-oxo-2,5-diazaspiro[3.4]octan-2-yl)acetyl]amino]-3-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(5-acetyl-3-oxo-2,5-diazaspiro[3.4]octan-2-yl)acetyl]amino]-3-methylbutanamide?
The IUPAC name of 2-[[2-(5-acetyl-3-oxo-2,5-diazaspiro[3.4]octan-2-yl)acetyl]amino]-3-methylbutanamide (CID 134486903) is 2-[[2-(5-acetyl-3-oxo-2,5-diazaspiro[3.4]octan-2-yl)acetyl]amino]-3-methylbutanamide.
What is the SMILES notation for 2-[[2-(5-acetyl-3-oxo-2,5-diazaspiro[3.4]octan-2-yl)acetyl]amino]-3-methylbutanamide?
The canonical SMILES for 2-[[2-(5-acetyl-3-oxo-2,5-diazaspiro[3.4]octan-2-yl)acetyl]amino]-3-methylbutanamide is CC(=O)N1CCCC12CN(CC(=O)NC(C(N)=O)C(C)C)C2=O.
What is the InChIKey of 2-[[2-(5-acetyl-3-oxo-2,5-diazaspiro[3.4]octan-2-yl)acetyl]amino]-3-methylbutanamide?
The InChIKey is WKAJVTJJOUZJSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N4O4/c1-9(2)12(13(16)22)17-11(21)7-18-8-15(14(18)23)5-4-6-19(15)10(3)20/h9,12H,4-8H2,1-3H3,(H2,16,22)(H,17,21).
What are the key properties of 2-[[2-(5-acetyl-3-oxo-2,5-diazaspiro[3.4]octan-2-yl)acetyl]amino]-3-methylbutanamide?
2-[[2-(5-acetyl-3-oxo-2,5-diazaspiro[3.4]octan-2-yl)acetyl]amino]-3-methylbutanamide has a molecular weight of 324.38 g/mol, XLogP of -1.16, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(5-acetyl-3-oxo-2,5-diazaspiro[3.4]octan-2-yl)acetyl]amino]-3-methylbutanamide is sourced from PubChem (CID 134486903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).