C21H30N2O3 — CID 134486939
[(1R,9R,10R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] N-(2-methoxyethyl)carbamate (PubChem CID 134486939) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is [(1R,9R,10R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] N-(2-methoxyethyl)carbamate.
| Compound Name | [(1R,9R,10R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] N-(2-methoxyethyl)carbamate |
|---|---|
| PubChem CID | 134486939 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | [(1R,9R,10R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] N-(2-methoxyethyl)carbamate |
| SMILES | COCCNC(=O)Oc1ccc2c(c1)[C@@]13CCCC[C@H]1[C@@H](C2)N(C)CC3 |
| InChI | InChI=1S/C21H30N2O3/c1-23-11-9-21-8-4-3-5-17(21)19(23)13-15-6-7-16(14-18(15)21)26-20(24)22-10-12-25-2/h6-7,14,17,19H,3-5,8-13H2,1-2H3,(H,22,24)/t17-,19+,21+/m0/s1 |
| InChIKey | OZNMIGSWQZSRCV-FBBABVLZSA-N |
| XLogP | 3.11 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|