C29H32N2O3 — CID 134487332
(5aS,6S,9aS)-6,9a-dimethyl-7-oxo-3-phenyl-2-(2-phenylmethoxyethyl)-4,5,5a,6,8,9-hexahydrobenzo[e]benzimidazole-8-carbaldehyde (PubChem CID 134487332) has the molecular formula C29H32N2O3 and a molecular weight of 456.59 g/mol. Its IUPAC name is (5aS,6S,9aS)-6,9a-dimethyl-7-oxo-3-phenyl-2-(2-phenylmethoxyethyl)-4,5,5a,6,8,9-hexahydrobenzo[e]benzimidazole-8-carbaldehyde.
| Compound Name | (5aS,6S,9aS)-6,9a-dimethyl-7-oxo-3-phenyl-2-(2-phenylmethoxyethyl)-4,5,5a,6,8,9-hexahydrobenzo[e]benzimidazole-8-carbaldehyde |
|---|---|
| PubChem CID | 134487332 |
| Molecular Formula | C29H32N2O3 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | (5aS,6S,9aS)-6,9a-dimethyl-7-oxo-3-phenyl-2-(2-phenylmethoxyethyl)-4,5,5a,6,8,9-hexahydrobenzo[e]benzimidazole-8-carbaldehyde |
| SMILES | C[C@@H]1C(=O)C(C=O)C[C@]2(C)c3nc(CCOCc4ccccc4)n(-c4ccccc4)c3CC[C@@H]12 |
| InChI | InChI=1S/C29H32N2O3/c1-20-24-13-14-25-28(29(24,2)17-22(18-32)27(20)33)30-26(31(25)23-11-7-4-8-12-23)15-16-34-19-21-9-5-3-6-10-21/h3-12,18,20,22,24H,13-17,19H2,1-2H3/t20-,22?,24-,29-/m0/s1 |
| InChIKey | UJNQYEMICNHYEJ-HMCGIMJNSA-N |
| XLogP | 4.88 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|