C29H28N4O2 — CID 134487339
(5aS,6S,9aS)-6-methyl-2-(1-methylpyrazol-4-yl)-7-oxo-3,9a-diphenyl-4,5,5a,6,8,9-hexahydrobenzo[e]benzimidazole-8-carbaldehyde (PubChem CID 134487339) has the molecular formula C29H28N4O2 and a molecular weight of 464.57 g/mol. Its IUPAC name is (5aS,6S,9aS)-6-methyl-2-(1-methylpyrazol-4-yl)-7-oxo-3,9a-diphenyl-4,5,5a,6,8,9-hexahydrobenzo[e]benzimidazole-8-carbaldehyde.
| Compound Name | (5aS,6S,9aS)-6-methyl-2-(1-methylpyrazol-4-yl)-7-oxo-3,9a-diphenyl-4,5,5a,6,8,9-hexahydrobenzo[e]benzimidazole-8-carbaldehyde |
|---|---|
| PubChem CID | 134487339 |
| Molecular Formula | C29H28N4O2 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | (5aS,6S,9aS)-6-methyl-2-(1-methylpyrazol-4-yl)-7-oxo-3,9a-diphenyl-4,5,5a,6,8,9-hexahydrobenzo[e]benzimidazole-8-carbaldehyde |
| SMILES | C[C@@H]1C(=O)C(C=O)C[C@]2(c3ccccc3)c3nc(-c4cnn(C)c4)n(-c4ccccc4)c3CC[C@@H]12 |
| InChI | InChI=1S/C29H28N4O2/c1-19-24-13-14-25-27(29(24,15-20(18-34)26(19)35)22-9-5-3-6-10-22)31-28(21-16-30-32(2)17-21)33(25)23-11-7-4-8-12-23/h3-12,16-20,24H,13-15H2,1-2H3/t19-,20?,24-,29+/m0/s1 |
| InChIKey | HDMJVFOMGCGHJG-UKBHVASGSA-N |
| XLogP | 4.55 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|