C22H22FIO4S — CID 134488230
ethyl (3R,3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-iodo-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalene-3-carboxylate (PubChem CID 134488230) has the molecular formula C22H22FIO4S and a molecular weight of 528.38 g/mol. Its IUPAC name is ethyl (3R,3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-iodo-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalene-3-carboxylate.
| Compound Name | ethyl (3R,3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-iodo-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalene-3-carboxylate |
|---|---|
| PubChem CID | 134488230 |
| Molecular Formula | C22H22FIO4S |
| Molecular Weight | 528.38 g/mol |
| Exact Mass | 528.03 |
| IUPAC Name | ethyl (3R,3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-iodo-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalene-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CC[C@]2(S(=O)(=O)c3ccc(F)cc3)c3ccc(I)cc3CC[C@H]12 |
| InChI | InChI=1S/C22H22FIO4S/c1-2-28-21(25)18-11-12-22(29(26,27)17-7-4-15(23)5-8-17)19-10-6-16(24)13-14(19)3-9-20(18)22/h4-8,10,13,18,20H,2-3,9,11-12H2,1H3/t18-,20-,22+/m1/s1 |
| InChIKey | FKVNCWOJMKXPHX-UZKOGDIHSA-N |
| XLogP | 4.64 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.38 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|