C14H14N2O3S — CID 1344884
N-[(2-hydroxy-4,5-dimethylphenyl)carbamothioyl]furan-2-carboxamide (PubChem CID 1344884) has the molecular formula C14H14N2O3S and a molecular weight of 290.34 g/mol. Its IUPAC name is N-[(2-hydroxy-4,5-dimethylphenyl)carbamothioyl]furan-2-carboxamide.
| Compound Name | N-[(2-hydroxy-4,5-dimethylphenyl)carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 1344884 |
| Molecular Formula | C14H14N2O3S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | N-[(2-hydroxy-4,5-dimethylphenyl)carbamothioyl]furan-2-carboxamide |
| SMILES | Cc1cc(O)c(NC(=S)NC(=O)c2ccco2)cc1C |
| InChI | InChI=1S/C14H14N2O3S/c1-8-6-10(11(17)7-9(8)2)15-14(20)16-13(18)12-4-3-5-19-12/h3-7,17H,1-2H3,(H2,15,16,18,20) |
| InChIKey | NPHZPEXOFAQXIW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|