C16H16O5 — CID 13448877
dimethyl 1,5-dimethyl-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene-9,10-dicarboxylate (PubChem CID 13448877) has the molecular formula C16H16O5 and a molecular weight of 288.30 g/mol. Its IUPAC name is dimethyl 1,5-dimethyl-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene-9,10-dicarboxylate.
| Compound Name | dimethyl 1,5-dimethyl-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene-9,10-dicarboxylate |
|---|---|
| PubChem CID | 13448877 |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | dimethyl 1,5-dimethyl-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene-9,10-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2(C)OC1c1cc(C)ccc12 |
| InChI | InChI=1S/C16H16O5/c1-8-5-6-10-9(7-8)13-11(14(17)19-3)12(15(18)20-4)16(10,2)21-13/h5-7,13H,1-4H3 |
| InChIKey | HAVNYXVMJPOPDU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |