C32H39F3N4O3 — CID 134489096
5-methyl-7-[6-[5-[2-(1,1,1-trifluoro-3-piperidin-4-ylpropan-2-yl)oxyethoxy]pentoxy]-3-pyridinyl]pyrido[4,3-b]indole (PubChem CID 134489096) has the molecular formula C32H39F3N4O3 and a molecular weight of 584.68 g/mol. Its IUPAC name is 5-methyl-7-[6-[5-[2-(1,1,1-trifluoro-3-piperidin-4-ylpropan-2-yl)oxyethoxy]pentoxy]-3-pyridinyl]pyrido[4,3-b]indole.
| Compound Name | 5-methyl-7-[6-[5-[2-(1,1,1-trifluoro-3-piperidin-4-ylpropan-2-yl)oxyethoxy]pentoxy]-3-pyridinyl]pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 134489096 |
| Molecular Formula | C32H39F3N4O3 |
| Molecular Weight | 584.68 g/mol |
| Exact Mass | 584.30 |
| IUPAC Name | 5-methyl-7-[6-[5-[2-(1,1,1-trifluoro-3-piperidin-4-ylpropan-2-yl)oxyethoxy]pentoxy]-3-pyridinyl]pyrido[4,3-b]indole |
| SMILES | Cn1c2ccncc2c2ccc(-c3ccc(OCCCCCOCCOC(CC4CCNCC4)C(F)(F)F)nc3)cc21 |
| InChI | InChI=1S/C32H39F3N4O3/c1-39-28-11-14-37-22-27(28)26-7-5-24(20-29(26)39)25-6-8-31(38-21-25)42-16-4-2-3-15-40-17-18-41-30(32(33,34)35)19-23-9-12-36-13-10-23/h5-8,11,14,20-23,30,36H,2-4,9-10,12-13,15-19H2,1H3 |
| InChIKey | KCAWUJGXTOXYEE-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 70.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.68 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|