About [3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]methanol
[3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]methanol (PubChem CID 134489254) has the molecular formula C21H19N3O2
and a molecular weight of 345.40 g/mol. Its IUPAC name is [3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]methanol.
Molecular Properties
| Compound Name | [3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]methanol |
| PubChem CID | 134489254 |
| Molecular Formula | C21H19N3O2 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | [3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]methanol |
| SMILES | OCC1CC(Oc2ccc(-c3ccc4c(c3)[nH]c3ccncc34)cn2)C1 |
| InChI | InChI=1S/C21H19N3O2/c25-12-13-7-16(8-13)26-21-4-2-15(10-23-21)14-1-3-17-18-11-22-6-5-19(18)24-20(17)9-14/h1-6,9-11,13,16,24-25H,7-8,12H2 |
| InChIKey | CSSQHDGDTFZGEX-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]methanol?
The IUPAC name of [3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]methanol (CID 134489254) is [3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]methanol.
What is the SMILES notation for [3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]methanol?
The canonical SMILES for [3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]methanol is OCC1CC(Oc2ccc(-c3ccc4c(c3)[nH]c3ccncc34)cn2)C1.
What is the InChIKey of [3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]methanol?
The InChIKey is CSSQHDGDTFZGEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19N3O2/c25-12-13-7-16(8-13)26-21-4-2-15(10-23-21)14-1-3-17-18-11-22-6-5-19(18)24-20(17)9-14/h1-6,9-11,13,16,24-25H,7-8,12H2.
What are the key properties of [3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]methanol?
[3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]methanol has a molecular weight of 345.40 g/mol, XLogP of 3.93, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]methanol is sourced from PubChem (CID 134489254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).