C25H38FNO2 — CID 134489455
4-[3-fluoro-4-[[4-[(E)-prop-1-enyl]cyclohexyl]methoxy]phenyl]-1-hydroxy-2,2,6,6-tetramethylpiperidine (PubChem CID 134489455) has the molecular formula C25H38FNO2 and a molecular weight of 403.58 g/mol. Its IUPAC name is 4-[3-fluoro-4-[[4-[(E)-prop-1-enyl]cyclohexyl]methoxy]phenyl]-1-hydroxy-2,2,6,6-tetramethylpiperidine.
| Compound Name | 4-[3-fluoro-4-[[4-[(E)-prop-1-enyl]cyclohexyl]methoxy]phenyl]-1-hydroxy-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 134489455 |
| Molecular Formula | C25H38FNO2 |
| Molecular Weight | 403.58 g/mol |
| Exact Mass | 403.29 |
| IUPAC Name | 4-[3-fluoro-4-[[4-[(E)-prop-1-enyl]cyclohexyl]methoxy]phenyl]-1-hydroxy-2,2,6,6-tetramethylpiperidine |
| SMILES | C/C=C/C1CCC(COc2ccc(C3CC(C)(C)N(O)C(C)(C)C3)cc2F)CC1 |
| InChI | InChI=1S/C25H38FNO2/c1-6-7-18-8-10-19(11-9-18)17-29-23-13-12-20(14-22(23)26)21-15-24(2,3)27(28)25(4,5)16-21/h6-7,12-14,18-19,21,28H,8-11,15-17H2,1-5H3/b7-6+ |
| InChIKey | FVAGMIZYORZKQJ-VOTSOKGWSA-N |
| XLogP | 6.71 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.58 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|