About 4-chloro-1,3-dimethylpyrazolo[3,4-b]quinoline
4-chloro-1,3-dimethylpyrazolo[3,4-b]quinoline (PubChem CID 13448999) has the molecular formula C12H10ClN3
and a molecular weight of 231.69 g/mol. Its IUPAC name is 4-chloro-1,3-dimethylpyrazolo[3,4-b]quinoline.
Molecular Properties
| Compound Name | 4-chloro-1,3-dimethylpyrazolo[3,4-b]quinoline |
| PubChem CID | 13448999 |
| Molecular Formula | C12H10ClN3 |
| Molecular Weight | 231.69 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 4-chloro-1,3-dimethylpyrazolo[3,4-b]quinoline |
| SMILES | Cc1nn(C)c2nc3ccccc3c(Cl)c12 |
| InChI | InChI=1S/C12H10ClN3/c1-7-10-11(13)8-5-3-4-6-9(8)14-12(10)16(2)15-7/h3-6H,1-2H3 |
| InChIKey | CLRNUDVGJVDYTG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.69 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-1,3-dimethylpyrazolo[3,4-b]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1,3-dimethylpyrazolo[3,4-b]quinoline?
The IUPAC name of 4-chloro-1,3-dimethylpyrazolo[3,4-b]quinoline (CID 13448999) is 4-chloro-1,3-dimethylpyrazolo[3,4-b]quinoline.
What is the SMILES notation for 4-chloro-1,3-dimethylpyrazolo[3,4-b]quinoline?
The canonical SMILES for 4-chloro-1,3-dimethylpyrazolo[3,4-b]quinoline is Cc1nn(C)c2nc3ccccc3c(Cl)c12.
What is the InChIKey of 4-chloro-1,3-dimethylpyrazolo[3,4-b]quinoline?
The InChIKey is CLRNUDVGJVDYTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClN3/c1-7-10-11(13)8-5-3-4-6-9(8)14-12(10)16(2)15-7/h3-6H,1-2H3.
What are the key properties of 4-chloro-1,3-dimethylpyrazolo[3,4-b]quinoline?
4-chloro-1,3-dimethylpyrazolo[3,4-b]quinoline has a molecular weight of 231.69 g/mol, XLogP of 3.08, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1,3-dimethylpyrazolo[3,4-b]quinoline is sourced from PubChem (CID 13448999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).