C15H31NO3S2 — CID 134490228
N-(1,3-dihydroxy-2-methylpropan-2-yl)-4,5-bis(propylsulfanyl)pentanamide (PubChem CID 134490228) has the molecular formula C15H31NO3S2 and a molecular weight of 337.55 g/mol. Its IUPAC name is N-(1,3-dihydroxy-2-methylpropan-2-yl)-4,5-bis(propylsulfanyl)pentanamide.
| Compound Name | N-(1,3-dihydroxy-2-methylpropan-2-yl)-4,5-bis(propylsulfanyl)pentanamide |
|---|---|
| PubChem CID | 134490228 |
| Molecular Formula | C15H31NO3S2 |
| Molecular Weight | 337.55 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | N-(1,3-dihydroxy-2-methylpropan-2-yl)-4,5-bis(propylsulfanyl)pentanamide |
| SMILES | CCCSCC(CCC(=O)NC(C)(CO)CO)SCCC |
| InChI | InChI=1S/C15H31NO3S2/c1-4-8-20-10-13(21-9-5-2)6-7-14(19)16-15(3,11-17)12-18/h13,17-18H,4-12H2,1-3H3,(H,16,19) |
| InChIKey | XJEVRRYJSYRUIH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.55 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|