C23H33NO5 — CID 134490341
(9R,10R)-4-hydroxy-17-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one (PubChem CID 134490341) has the molecular formula C23H33NO5 and a molecular weight of 403.52 g/mol. Its IUPAC name is (9R,10R)-4-hydroxy-17-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one.
| Compound Name | (9R,10R)-4-hydroxy-17-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one |
|---|---|
| PubChem CID | 134490341 |
| Molecular Formula | C23H33NO5 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | (9R,10R)-4-hydroxy-17-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one |
| SMILES | COCCOCCOCCN1CCC23CC(=O)CC[C@H]2[C@H]1Cc1ccc(O)cc13 |
| InChI | InChI=1S/C23H33NO5/c1-27-10-11-29-13-12-28-9-8-24-7-6-23-16-19(26)4-5-20(23)22(24)14-17-2-3-18(25)15-21(17)23/h2-3,15,20,22,25H,4-14,16H2,1H3/t20-,22+,23?/m0/s1 |
| InChIKey | NPXLSLUYOKNJLW-PDOMDSBESA-N |
| XLogP | 2.31 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|