About 5-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1-methyl-2,3-dihydropyridin-6-one
5-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1-methyl-2,3-dihydropyridin-6-one (PubChem CID 134490391) has the molecular formula C12H15NO
and a molecular weight of 189.26 g/mol. Its IUPAC name is 5-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1-methyl-2,3-dihydropyridin-6-one.
Molecular Properties
| Compound Name | 5-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1-methyl-2,3-dihydropyridin-6-one |
| PubChem CID | 134490391 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 5-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1-methyl-2,3-dihydropyridin-6-one |
| SMILES | C=C/C=C\C1=C(C=C)CCN(C)C1=O |
| InChI | InChI=1S/C12H15NO/c1-4-6-7-11-10(5-2)8-9-13(3)12(11)14/h4-7H,1-2,8-9H2,3H3/b7-6- |
| InChIKey | WKPDKKWNKYGOJW-SREVYHEPSA-N |
| XLogP | 2.07 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1-methyl-2,3-dihydropyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1-methyl-2,3-dihydropyridin-6-one?
The IUPAC name of 5-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1-methyl-2,3-dihydropyridin-6-one (CID 134490391) is 5-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1-methyl-2,3-dihydropyridin-6-one.
What is the SMILES notation for 5-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1-methyl-2,3-dihydropyridin-6-one?
The canonical SMILES for 5-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1-methyl-2,3-dihydropyridin-6-one is C=C/C=C\C1=C(C=C)CCN(C)C1=O.
What is the InChIKey of 5-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1-methyl-2,3-dihydropyridin-6-one?
The InChIKey is WKPDKKWNKYGOJW-SREVYHEPSA-N. The full InChI is InChI=1S/C12H15NO/c1-4-6-7-11-10(5-2)8-9-13(3)12(11)14/h4-7H,1-2,8-9H2,3H3/b7-6-.
What are the key properties of 5-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1-methyl-2,3-dihydropyridin-6-one?
5-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1-methyl-2,3-dihydropyridin-6-one has a molecular weight of 189.26 g/mol, XLogP of 2.07, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1-methyl-2,3-dihydropyridin-6-one is sourced from PubChem (CID 134490391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).