C19H26ClN3O — CID 134490399
N-[(9R,10R)-5-amino-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-yl]-2-chloroacetamide (PubChem CID 134490399) has the molecular formula C19H26ClN3O and a molecular weight of 347.89 g/mol. Its IUPAC name is N-[(9R,10R)-5-amino-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-yl]-2-chloroacetamide.
| Compound Name | N-[(9R,10R)-5-amino-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-yl]-2-chloroacetamide |
|---|---|
| PubChem CID | 134490399 |
| Molecular Formula | C19H26ClN3O |
| Molecular Weight | 347.89 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | N-[(9R,10R)-5-amino-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-yl]-2-chloroacetamide |
| SMILES | CN1CCC23CCCC[C@H]2[C@H]1Cc1cc(N)c(NC(=O)CCl)cc13 |
| InChI | InChI=1S/C19H26ClN3O/c1-23-7-6-19-5-3-2-4-13(19)17(23)9-12-8-15(21)16(10-14(12)19)22-18(24)11-20/h8,10,13,17H,2-7,9,11,21H2,1H3,(H,22,24)/t13-,17+,19?/m0/s1 |
| InChIKey | BUOIWMJBUYPCAR-JQKBXSLYSA-N |
| XLogP | 3.13 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.89 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|