C21H13NO3 — CID 13449074
methyl 10-oxo-14-phenyl-13-azatetracyclo[9.2.1.04,13.07,12]tetradeca-1,3,5,7(12),8,11(14)-hexaene-3-carboxylate (PubChem CID 13449074) has the molecular formula C21H13NO3 and a molecular weight of 327.34 g/mol. Its IUPAC name is methyl 10-oxo-14-phenyl-13-azatetracyclo[9.2.1.04,13.07,12]tetradeca-1,3,5,7(12),8,11(14)-hexaene-3-carboxylate.
| Compound Name | methyl 10-oxo-14-phenyl-13-azatetracyclo[9.2.1.04,13.07,12]tetradeca-1,3,5,7(12),8,11(14)-hexaene-3-carboxylate |
|---|---|
| PubChem CID | 13449074 |
| Molecular Formula | C21H13NO3 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | methyl 10-oxo-14-phenyl-13-azatetracyclo[9.2.1.04,13.07,12]tetradeca-1,3,5,7(12),8,11(14)-hexaene-3-carboxylate |
| SMILES | COC(=O)c1cc2c(-c3ccccc3)c3c(=O)ccc4ccc1n2c43 |
| InChI | InChI=1S/C21H13NO3/c1-25-21(24)14-11-16-18(12-5-3-2-4-6-12)19-17(23)10-8-13-7-9-15(14)22(16)20(13)19/h2-11H,1H3 |
| InChIKey | UQMUTZCATOFJHE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |