About 4-(5-ethoxycarbonyl-2-oxo-1,3-dioxan-5-yl)but-2-enyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate
4-(5-ethoxycarbonyl-2-oxo-1,3-dioxan-5-yl)but-2-enyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate (PubChem CID 134490873) has the molecular formula C17H22O10
and a molecular weight of 386.35 g/mol. Its IUPAC name is 4-(5-ethoxycarbonyl-2-oxo-1,3-dioxan-5-yl)but-2-enyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate.
Molecular Properties
| Compound Name | 4-(5-ethoxycarbonyl-2-oxo-1,3-dioxan-5-yl)but-2-enyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate |
| PubChem CID | 134490873 |
| Molecular Formula | C17H22O10 |
| Molecular Weight | 386.35 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 4-(5-ethoxycarbonyl-2-oxo-1,3-dioxan-5-yl)but-2-enyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate |
| SMILES | CCOC(=O)C1(CC=CCOC(=O)C2(C)COC(=O)OC2)COC(=O)OC1 |
| InChI | InChI=1S/C17H22O10/c1-3-22-13(19)17(10-26-15(21)27-11-17)6-4-5-7-23-12(18)16(2)8-24-14(20)25-9-16/h4-5H,3,6-11H2,1-2H3 |
| InChIKey | KDYKPDAUDRWUSZ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.35 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-ethoxycarbonyl-2-oxo-1,3-dioxan-5-yl)but-2-enyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-ethoxycarbonyl-2-oxo-1,3-dioxan-5-yl)but-2-enyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate?
The IUPAC name of 4-(5-ethoxycarbonyl-2-oxo-1,3-dioxan-5-yl)but-2-enyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate (CID 134490873) is 4-(5-ethoxycarbonyl-2-oxo-1,3-dioxan-5-yl)but-2-enyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate.
What is the SMILES notation for 4-(5-ethoxycarbonyl-2-oxo-1,3-dioxan-5-yl)but-2-enyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate?
The canonical SMILES for 4-(5-ethoxycarbonyl-2-oxo-1,3-dioxan-5-yl)but-2-enyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate is CCOC(=O)C1(CC=CCOC(=O)C2(C)COC(=O)OC2)COC(=O)OC1.
What is the InChIKey of 4-(5-ethoxycarbonyl-2-oxo-1,3-dioxan-5-yl)but-2-enyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate?
The InChIKey is KDYKPDAUDRWUSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22O10/c1-3-22-13(19)17(10-26-15(21)27-11-17)6-4-5-7-23-12(18)16(2)8-24-14(20)25-9-16/h4-5H,3,6-11H2,1-2H3.
What are the key properties of 4-(5-ethoxycarbonyl-2-oxo-1,3-dioxan-5-yl)but-2-enyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate?
4-(5-ethoxycarbonyl-2-oxo-1,3-dioxan-5-yl)but-2-enyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate has a molecular weight of 386.35 g/mol, XLogP of 1.37, 7 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-ethoxycarbonyl-2-oxo-1,3-dioxan-5-yl)but-2-enyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate is sourced from PubChem (CID 134490873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).