About 2,3-dihydrothiepino[2,3-b]furan
2,3-dihydrothiepino[2,3-b]furan (PubChem CID 134491034) has the molecular formula C8H8OS
and a molecular weight of 152.22 g/mol. Its IUPAC name is 2,3-dihydrothiepino[2,3-b]furan.
Molecular Properties
| Compound Name | 2,3-dihydrothiepino[2,3-b]furan |
| PubChem CID | 134491034 |
| Molecular Formula | C8H8OS |
| Molecular Weight | 152.22 g/mol |
| Exact Mass | 152.03 |
| IUPAC Name | 2,3-dihydrothiepino[2,3-b]furan |
| SMILES | C1=CSC2=C(C=C1)CCO2 |
| InChI | InChI=1S/C8H8OS/c1-2-6-10-8-7(3-1)4-5-9-8/h1-3,6H,4-5H2 |
| InChIKey | HBBDZWOTCRGJHQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.22 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dihydrothiepino[2,3-b]furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydrothiepino[2,3-b]furan?
The IUPAC name of 2,3-dihydrothiepino[2,3-b]furan (CID 134491034) is 2,3-dihydrothiepino[2,3-b]furan.
What is the SMILES notation for 2,3-dihydrothiepino[2,3-b]furan?
The canonical SMILES for 2,3-dihydrothiepino[2,3-b]furan is C1=CSC2=C(C=C1)CCO2.
What is the InChIKey of 2,3-dihydrothiepino[2,3-b]furan?
The InChIKey is HBBDZWOTCRGJHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8OS/c1-2-6-10-8-7(3-1)4-5-9-8/h1-3,6H,4-5H2.
What are the key properties of 2,3-dihydrothiepino[2,3-b]furan?
2,3-dihydrothiepino[2,3-b]furan has a molecular weight of 152.22 g/mol, XLogP of 2.43, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydrothiepino[2,3-b]furan is sourced from PubChem (CID 134491034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).