C8H17NO2 — CID 134491150
(1R,2S,4R)-4-(dimethylamino)cyclohexane-1,2-diol (PubChem CID 134491150) has the molecular formula C8H17NO2 and a molecular weight of 159.23 g/mol. Its IUPAC name is (1R,2S,4R)-4-(dimethylamino)cyclohexane-1,2-diol.
| Compound Name | (1R,2S,4R)-4-(dimethylamino)cyclohexane-1,2-diol |
|---|---|
| PubChem CID | 134491150 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | (1R,2S,4R)-4-(dimethylamino)cyclohexane-1,2-diol |
| SMILES | CN(C)[C@@H]1CC[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C8H17NO2/c1-9(2)6-3-4-7(10)8(11)5-6/h6-8,10-11H,3-5H2,1-2H3/t6-,7-,8+/m1/s1 |
| InChIKey | OMWOZMVYFRCQOH-PRJMDXOYSA-N |
| XLogP | -0.18 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |