C28H25F10NO3S — CID 134491262
(3R,3aS,9bS)-N-(3,3-difluorocyclopentyl)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalene-3-carboxamide (PubChem CID 134491262) has the molecular formula C28H25F10NO3S and a molecular weight of 645.56 g/mol. Its IUPAC name is (3R,3aS,9bS)-N-(3,3-difluorocyclopentyl)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalene-3-carboxamide.
| Compound Name | (3R,3aS,9bS)-N-(3,3-difluorocyclopentyl)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalene-3-carboxamide |
|---|---|
| PubChem CID | 134491262 |
| Molecular Formula | C28H25F10NO3S |
| Molecular Weight | 645.56 g/mol |
| Exact Mass | 645.14 |
| IUPAC Name | (3R,3aS,9bS)-N-(3,3-difluorocyclopentyl)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalene-3-carboxamide |
| SMILES | O=C(NC1CCC(F)(F)C1)[C@@H]1CC[C@@]2(S(=O)(=O)c3ccc(F)cc3)c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CC[C@@H]12 |
| InChI | InChI=1S/C28H25F10NO3S/c29-17-3-5-19(6-4-17)43(41,42)25-12-10-20(23(40)39-18-9-11-24(30,31)14-18)22(25)7-1-15-13-16(2-8-21(15)25)26(32,27(33,34)35)28(36,37)38/h2-6,8,13,18,20,22H,1,7,9-12,14H2,(H,39,40)/t18?,20-,22+,25-/m1/s1 |
| InChIKey | JHHDINUQADWLSR-QVAYSRPASA-N |
| XLogP | 7.06 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.56 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |