C22H19F8NO2S — CID 134491275
(3S,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-amine (PubChem CID 134491275) has the molecular formula C22H19F8NO2S and a molecular weight of 513.45 g/mol. Its IUPAC name is (3S,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-amine.
| Compound Name | (3S,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-amine |
|---|---|
| PubChem CID | 134491275 |
| Molecular Formula | C22H19F8NO2S |
| Molecular Weight | 513.45 g/mol |
| Exact Mass | 513.10 |
| IUPAC Name | (3S,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-amine |
| SMILES | N[C@H]1CC[C@@]2(S(=O)(=O)c3ccc(F)cc3)c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CC[C@@H]12 |
| InChI | InChI=1S/C22H19F8NO2S/c23-14-3-5-15(6-4-14)34(32,33)19-10-9-18(31)17(19)7-1-12-11-13(2-8-16(12)19)20(24,21(25,26)27)22(28,29)30/h2-6,8,11,17-18H,1,7,9-10,31H2/t17-,18-,19+/m0/s1 |
| InChIKey | LGFJTUVGPSWGPD-GBESFXJTSA-N |
| XLogP | 5.47 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.45 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |