C25H24F8N2O4S — CID 134491323
1-[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]-3-(2-hydroxyethyl)urea (PubChem CID 134491323) has the molecular formula C25H24F8N2O4S and a molecular weight of 600.53 g/mol. Its IUPAC name is 1-[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]-3-(2-hydroxyethyl)urea.
| Compound Name | 1-[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]-3-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 134491323 |
| Molecular Formula | C25H24F8N2O4S |
| Molecular Weight | 600.53 g/mol |
| Exact Mass | 600.13 |
| IUPAC Name | 1-[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]-3-(2-hydroxyethyl)urea |
| SMILES | O=C(NCCO)N[C@@H]1CC[C@@]2(S(=O)(=O)c3ccc(F)cc3)c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CC[C@@H]12 |
| InChI | InChI=1S/C25H24F8N2O4S/c26-16-3-5-17(6-4-16)40(38,39)22-10-9-20(35-21(37)34-11-12-36)19(22)7-1-14-13-15(2-8-18(14)22)23(27,24(28,29)30)25(31,32)33/h2-6,8,13,19-20,36H,1,7,9-12H2,(H2,34,35,37)/t19-,20+,22+/m0/s1 |
| InChIKey | XSLZOVDVKRRVRO-TUNNFDKTSA-N |
| XLogP | 4.80 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.53 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |