C23H18F8O4S — CID 134491352
(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalene-3-carboxylic acid (PubChem CID 134491352) has the molecular formula C23H18F8O4S and a molecular weight of 542.44 g/mol. Its IUPAC name is (3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalene-3-carboxylic acid.
| Compound Name | (3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalene-3-carboxylic acid |
|---|---|
| PubChem CID | 134491352 |
| Molecular Formula | C23H18F8O4S |
| Molecular Weight | 542.44 g/mol |
| Exact Mass | 542.08 |
| IUPAC Name | (3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalene-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CC[C@@]2(S(=O)(=O)c3ccc(F)cc3)c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CC[C@@H]12 |
| InChI | InChI=1S/C23H18F8O4S/c24-14-3-5-15(6-4-14)36(34,35)20-10-9-16(19(32)33)18(20)7-1-12-11-13(2-8-17(12)20)21(25,22(26,27)28)23(29,30)31/h2-6,8,11,16,18H,1,7,9-10H2,(H,32,33)/t16-,18+,20-/m1/s1 |
| InChIKey | LQYAMKMLVIKMDX-IMFGXOCKSA-N |
| XLogP | 5.84 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.44 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |