C24H22F8N2O5S2 — CID 134491462
N-[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]-2-sulfamoylacetamide (PubChem CID 134491462) has the molecular formula C24H22F8N2O5S2 and a molecular weight of 634.57 g/mol. Its IUPAC name is N-[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]-2-sulfamoylacetamide.
| Compound Name | N-[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]-2-sulfamoylacetamide |
|---|---|
| PubChem CID | 134491462 |
| Molecular Formula | C24H22F8N2O5S2 |
| Molecular Weight | 634.57 g/mol |
| Exact Mass | 634.08 |
| IUPAC Name | N-[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]-2-sulfamoylacetamide |
| SMILES | NS(=O)(=O)CC(=O)N[C@@H]1CC[C@@]2(S(=O)(=O)c3ccc(F)cc3)c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CC[C@@H]12 |
| InChI | InChI=1S/C24H22F8N2O5S2/c25-15-3-5-16(6-4-15)41(38,39)21-10-9-19(34-20(35)12-40(33,36)37)18(21)7-1-13-11-14(2-8-17(13)21)22(26,23(27,28)29)24(30,31)32/h2-6,8,11,18-19H,1,7,9-10,12H2,(H,34,35)(H2,33,36,37)/t18-,19+,21+/m0/s1 |
| InChIKey | NCNRCEJPYGIIKM-QKNQBKEWSA-N |
| XLogP | 3.91 |
| TPSA | 123.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |