C28H27F8NO5S2 — CID 134491501
N-[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]-1,1-dioxothiane-4-carboxamide (PubChem CID 134491501) has the molecular formula C28H27F8NO5S2 and a molecular weight of 673.64 g/mol. Its IUPAC name is N-[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]-1,1-dioxothiane-4-carboxamide.
| Compound Name | N-[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]-1,1-dioxothiane-4-carboxamide |
|---|---|
| PubChem CID | 134491501 |
| Molecular Formula | C28H27F8NO5S2 |
| Molecular Weight | 673.64 g/mol |
| Exact Mass | 673.12 |
| IUPAC Name | N-[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]-1,1-dioxothiane-4-carboxamide |
| SMILES | O=C(N[C@@H]1CC[C@@]2(S(=O)(=O)c3ccc(F)cc3)c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CC[C@@H]12)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C28H27F8NO5S2/c29-19-3-5-20(6-4-19)44(41,42)25-12-9-23(37-24(38)16-10-13-43(39,40)14-11-16)22(25)7-1-17-15-18(2-8-21(17)25)26(30,27(31,32)33)28(34,35)36/h2-6,8,15-16,22-23H,1,7,9-14H2,(H,37,38)/t22-,23+,25+/m0/s1 |
| InChIKey | LOOWXSUDJJEUCC-JBRSBNLGSA-N |
| XLogP | 5.45 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.64 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |