C24H21F8NO4S — CID 134491671
N-[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]-2-hydroxyacetamide (PubChem CID 134491671) has the molecular formula C24H21F8NO4S and a molecular weight of 571.49 g/mol. Its IUPAC name is N-[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]-2-hydroxyacetamide.
| Compound Name | N-[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]-2-hydroxyacetamide |
|---|---|
| PubChem CID | 134491671 |
| Molecular Formula | C24H21F8NO4S |
| Molecular Weight | 571.49 g/mol |
| Exact Mass | 571.11 |
| IUPAC Name | N-[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]-2-hydroxyacetamide |
| SMILES | O=C(CO)N[C@@H]1CC[C@@]2(S(=O)(=O)c3ccc(F)cc3)c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CC[C@@H]12 |
| InChI | InChI=1S/C24H21F8NO4S/c25-15-3-5-16(6-4-15)38(36,37)21-10-9-19(33-20(35)12-34)18(21)7-1-13-11-14(2-8-17(13)21)22(26,23(27,28)29)24(30,31)32/h2-6,8,11,18-19,34H,1,7,9-10,12H2,(H,33,35)/t18-,19+,21+/m0/s1 |
| InChIKey | UXPXBHXKLNFAJO-QKNQBKEWSA-N |
| XLogP | 4.62 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |