C35H39NO6S — CID 134491995
(1S,4R,6S,8S,9S,11S,13R)-6-[4-(4-aminophenyl)sulfanylphenyl]-11-hydroxy-8-(2-hydroxyacetyl)-6,9,13-trimethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one (PubChem CID 134491995) has the molecular formula C35H39NO6S and a molecular weight of 601.77 g/mol. Its IUPAC name is (1S,4R,6S,8S,9S,11S,13R)-6-[4-(4-aminophenyl)sulfanylphenyl]-11-hydroxy-8-(2-hydroxyacetyl)-6,9,13-trimethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one.
| Compound Name | (1S,4R,6S,8S,9S,11S,13R)-6-[4-(4-aminophenyl)sulfanylphenyl]-11-hydroxy-8-(2-hydroxyacetyl)-6,9,13-trimethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one |
|---|---|
| PubChem CID | 134491995 |
| Molecular Formula | C35H39NO6S |
| Molecular Weight | 601.77 g/mol |
| Exact Mass | 601.25 |
| IUPAC Name | (1S,4R,6S,8S,9S,11S,13R)-6-[4-(4-aminophenyl)sulfanylphenyl]-11-hydroxy-8-(2-hydroxyacetyl)-6,9,13-trimethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one |
| SMILES | C[C@]1(c2ccc(Sc3ccc(N)cc3)cc2)O[C@@H]2CC3[C@@H]4CCC5=CC(=O)C=C[C@]5(C)C4C(O)C[C@]3(C)[C@]2(C(=O)CO)O1 |
| InChI | InChI=1S/C35H39NO6S/c1-32-15-14-23(38)16-21(32)6-13-26-27-17-30-35(29(40)19-37,33(27,2)18-28(39)31(26)32)42-34(3,41-30)20-4-9-24(10-5-20)43-25-11-7-22(36)8-12-25/h4-5,7-12,14-16,26-28,30-31,37,39H,6,13,17-19,36H2,1-3H3/t26-,27?,28?,30+,31?,32-,33-,34-,35+/m0/s1 |
| InChIKey | OJVZKFXAMCVCKM-MDQPOZGZSA-N |
| XLogP | 5.20 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.77 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|