C15H15FN2O3 — CID 134492118
4-[(5-fluoro-2-methoxyphenyl)methylamino]-N-hydroxybenzamide (PubChem CID 134492118) has the molecular formula C15H15FN2O3 and a molecular weight of 290.29 g/mol. Its IUPAC name is 4-[(5-fluoro-2-methoxyphenyl)methylamino]-N-hydroxybenzamide.
| Compound Name | 4-[(5-fluoro-2-methoxyphenyl)methylamino]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 134492118 |
| Molecular Formula | C15H15FN2O3 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 4-[(5-fluoro-2-methoxyphenyl)methylamino]-N-hydroxybenzamide |
| SMILES | COc1ccc(F)cc1CNc1ccc(C(=O)NO)cc1 |
| InChI | InChI=1S/C15H15FN2O3/c1-21-14-7-4-12(16)8-11(14)9-17-13-5-2-10(3-6-13)15(19)18-20/h2-8,17,20H,9H2,1H3,(H,18,19) |
| InChIKey | JWQKGJSFFPCFSU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|