C34H37NO7S — CID 134492130
(1R,2S,4R,6R,8S,9S,12S,13R)-6-[4-(4-aminophenyl)sulfonylphenyl]-8-(2-hydroxyacetyl)-9,13-dimethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one (PubChem CID 134492130) has the molecular formula C34H37NO7S and a molecular weight of 603.74 g/mol. Its IUPAC name is (1R,2S,4R,6R,8S,9S,12S,13R)-6-[4-(4-aminophenyl)sulfonylphenyl]-8-(2-hydroxyacetyl)-9,13-dimethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one.
| Compound Name | (1R,2S,4R,6R,8S,9S,12S,13R)-6-[4-(4-aminophenyl)sulfonylphenyl]-8-(2-hydroxyacetyl)-9,13-dimethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one |
|---|---|
| PubChem CID | 134492130 |
| Molecular Formula | C34H37NO7S |
| Molecular Weight | 603.74 g/mol |
| Exact Mass | 603.23 |
| IUPAC Name | (1R,2S,4R,6R,8S,9S,12S,13R)-6-[4-(4-aminophenyl)sulfonylphenyl]-8-(2-hydroxyacetyl)-9,13-dimethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one |
| SMILES | C[C@]12C=CC(=O)C=C1CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1C[C@H]1O[C@@H](c3ccc(S(=O)(=O)c4ccc(N)cc4)cc3)O[C@]12C(=O)CO |
| InChI | InChI=1S/C34H37NO7S/c1-32-15-13-23(37)17-21(32)5-12-26-27(32)14-16-33(2)28(26)18-30-34(33,29(38)19-36)42-31(41-30)20-3-8-24(9-4-20)43(39,40)25-10-6-22(35)7-11-25/h3-4,6-11,13,15,17,26-28,30-31,36H,5,12,14,16,18-19,35H2,1-2H3/t26-,27+,28+,30-,31-,32+,33+,34-/m1/s1 |
| InChIKey | HLBZSSFPVJZMEU-KQTPDZDSSA-N |
| XLogP | 4.73 |
| TPSA | 132.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.74 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|