C25H23F3N4 — CID 134492149
8-ethenyl-8,9-dimethyl-11-(2-methylphenyl)-15-(trifluoromethyl)-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaene (PubChem CID 134492149) has the molecular formula C25H23F3N4 and a molecular weight of 436.48 g/mol. Its IUPAC name is 8-ethenyl-8,9-dimethyl-11-(2-methylphenyl)-15-(trifluoromethyl)-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaene.
| Compound Name | 8-ethenyl-8,9-dimethyl-11-(2-methylphenyl)-15-(trifluoromethyl)-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaene |
|---|---|
| PubChem CID | 134492149 |
| Molecular Formula | C25H23F3N4 |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 8-ethenyl-8,9-dimethyl-11-(2-methylphenyl)-15-(trifluoromethyl)-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaene |
| SMILES | C=CC1(C)c2ccccc2N2c3nc(C(F)(F)F)cnc3N(c3ccccc3C)C2C1C |
| InChI | InChI=1S/C25H23F3N4/c1-5-24(4)16(3)23-31(18-12-8-6-10-15(18)2)21-22(30-20(14-29-21)25(26,27)28)32(23)19-13-9-7-11-17(19)24/h5-14,16,23H,1H2,2-4H3 |
| InChIKey | XYEDLXORZOAUGO-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|