C12H10N4O6 — CID 13449232
5-(3,4-dinitrophenyl)-4,6-dimethoxypyrimidine (PubChem CID 13449232) has the molecular formula C12H10N4O6 and a molecular weight of 306.23 g/mol. Its IUPAC name is 5-(3,4-dinitrophenyl)-4,6-dimethoxypyrimidine.
| Compound Name | 5-(3,4-dinitrophenyl)-4,6-dimethoxypyrimidine |
|---|---|
| PubChem CID | 13449232 |
| Molecular Formula | C12H10N4O6 |
| Molecular Weight | 306.23 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 5-(3,4-dinitrophenyl)-4,6-dimethoxypyrimidine |
| SMILES | COc1ncnc(OC)c1-c1ccc([N+](=O)[O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H10N4O6/c1-21-11-10(12(22-2)14-6-13-11)7-3-4-8(15(17)18)9(5-7)16(19)20/h3-6H,1-2H3 |
| InChIKey | ZBVNQGZVCUEQKB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 130.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.23 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|