About 4-methyl-3-methylidene-1,2,3a,7a-tetrahydroisoindole
4-methyl-3-methylidene-1,2,3a,7a-tetrahydroisoindole (PubChem CID 134492848) has the molecular formula C10H13N
and a molecular weight of 147.22 g/mol. Its IUPAC name is 4-methyl-3-methylidene-1,2,3a,7a-tetrahydroisoindole.
Analyze 4-methyl-3-methylidene-1,2,3a,7a-tetrahydroisoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3-methylidene-1,2,3a,7a-tetrahydroisoindole?
The IUPAC name of 4-methyl-3-methylidene-1,2,3a,7a-tetrahydroisoindole (CID 134492848) is 4-methyl-3-methylidene-1,2,3a,7a-tetrahydroisoindole.
What is the SMILES notation for 4-methyl-3-methylidene-1,2,3a,7a-tetrahydroisoindole?
The canonical SMILES for 4-methyl-3-methylidene-1,2,3a,7a-tetrahydroisoindole is C=C1NCC2C=CC=C(C)C12.
What is the InChIKey of 4-methyl-3-methylidene-1,2,3a,7a-tetrahydroisoindole?
The InChIKey is OKLMIAOTLBZHRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N/c1-7-4-3-5-9-6-11-8(2)10(7)9/h3-5,9-11H,2,6H2,1H3.
What are the key properties of 4-methyl-3-methylidene-1,2,3a,7a-tetrahydroisoindole?
4-methyl-3-methylidene-1,2,3a,7a-tetrahydroisoindole has a molecular weight of 147.22 g/mol, XLogP of 1.85, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-methylidene-1,2,3a,7a-tetrahydroisoindole is sourced from PubChem (CID 134492848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).