C35H37F4N5O3 — CID 134493071
(E)-N,N-dimethyl-4-[2-[[5-[(Z)-4,4,4-trifluoro-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]but-2-enamide (PubChem CID 134493071) has the molecular formula C35H37F4N5O3 and a molecular weight of 651.71 g/mol. Its IUPAC name is (E)-N,N-dimethyl-4-[2-[[5-[(Z)-4,4,4-trifluoro-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]but-2-enamide.
| Compound Name | (E)-N,N-dimethyl-4-[2-[[5-[(Z)-4,4,4-trifluoro-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]but-2-enamide |
|---|---|
| PubChem CID | 134493071 |
| Molecular Formula | C35H37F4N5O3 |
| Molecular Weight | 651.71 g/mol |
| Exact Mass | 651.28 |
| IUPAC Name | (E)-N,N-dimethyl-4-[2-[[5-[(Z)-4,4,4-trifluoro-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]but-2-enamide |
| SMILES | CN(C)C(=O)/C=C/CNCCOc1ccc(/C(=C(/CC(F)(F)F)c2ccccc2)c2ccc3c(c2)c(F)nn3C2CCCCO2)cn1 |
| InChI | InChI=1S/C35H37F4N5O3/c1-43(2)31(45)11-8-17-40-18-20-46-30-16-14-26(23-41-30)33(28(22-35(37,38)39)24-9-4-3-5-10-24)25-13-15-29-27(21-25)34(36)42-44(29)32-12-6-7-19-47-32/h3-5,8-11,13-16,21,23,32,40H,6-7,12,17-20,22H2,1-2H3/b11-8+,33-28- |
| InChIKey | RDPKOUKBHRXCBP-RKPBPEKPSA-N |
| XLogP | 6.79 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.71 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|