C22H25N3O2 — CID 134493276
methyl 5-[[1-(3-cyanophenyl)piperidin-4-yl]amino]-2,4-dimethylbenzoate (PubChem CID 134493276) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is methyl 5-[[1-(3-cyanophenyl)piperidin-4-yl]amino]-2,4-dimethylbenzoate.
| Compound Name | methyl 5-[[1-(3-cyanophenyl)piperidin-4-yl]amino]-2,4-dimethylbenzoate |
|---|---|
| PubChem CID | 134493276 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | methyl 5-[[1-(3-cyanophenyl)piperidin-4-yl]amino]-2,4-dimethylbenzoate |
| SMILES | COC(=O)c1cc(NC2CCN(c3cccc(C#N)c3)CC2)c(C)cc1C |
| InChI | InChI=1S/C22H25N3O2/c1-15-11-16(2)21(13-20(15)22(26)27-3)24-18-7-9-25(10-8-18)19-6-4-5-17(12-19)14-23/h4-6,11-13,18,24H,7-10H2,1-3H3 |
| InChIKey | NJXHZLKFCZXRHG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |